Olympiad Maths Prep

Track / Stage 5 / 214 of 400 #814 of 2000

Problem 814

AIME late
Combinatorics Difficulty 5.5 Find the answer

Example 6. Two dice are rolled, and the number of points that fall on both top faces is counted. Find the distribution law of the discrete random variable XX - the sum of the points that fall on two dice.

---

The provided translation maintains the original text's formatting and structure.

Official solution

Solution. In this trial, there are 36 equally possible elementary outcomes (see Table 1.1). The random variable XX can take integer values from 2 to 12, where the values 2 and 12 occur once, 3 and 11 - twice, 4 and 10 - three times, 5 and 9 - four times, 6 and 8 - five times, and the value 7 - six times.

Let's calculate the probabilities of these values:

p1=P(X=2)=136,p2=P(X=3)=236=118,p3=P(X=4)=336=112p4=P(X=5)=436=19,p5=P(X=6)=536,p6=P(X=7)=636=16p7=P(X=8)=536,p8=P(X=9)=436=19,p9=P(X=10)=336=112p10=P(X=11)=236=118,p11=P(X=12)=136 \begin{gathered} p_{1}=P(X=2)=\frac{1}{36}, p_{2}=P(X=3)=\frac{2}{36}=\frac{1}{18}, p_{3}=P(X=4)=\frac{3}{36}=\frac{1}{12} \\ p_{4}=P(X=5)=\frac{4}{36}=\frac{1}{9}, p_{5}=P(X=6)=\frac{5}{36}, p_{6}=P(X=7)=\frac{6}{36}=\frac{1}{6} \\ p_{7}=P(X=8)=\frac{5}{36}, p_{8}=P(X=9)=\frac{4}{36}=\frac{1}{9}, p_{9}=P(X=10)=\frac{3}{36}=\frac{1}{12} \\ p_{10}=P(X=11)=\frac{2}{36}=\frac{1}{18}, p_{11}=P(X=12)=\frac{1}{36} \end{gathered}

Therefore, the distribution law of the random variable XX can be given by the table

| XX | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 |
| :---: | :---: | :---: | :---: | :---: | :---: | :---: | :---: | :---: | :---: | :---: | :---: |
| PP | 136\frac{1}{36} | 118\frac{1}{18} | 112\frac{1}{12} | 19\frac{1}{9} | 536\frac{5}{36} | 16\frac{1}{6} | 536\frac{5}{36} | 19\frac{1}{9} | 112\frac{1}{12} | 118\frac{1}{18} | 136\frac{1}{36} |

Note that

136+118+112+19+536+16+536+19+112+118+136=1 \frac{1}{36}+\frac{1}{18}+\frac{1}{12}+\frac{1}{9}+\frac{5}{36}+\frac{1}{6}+\frac{5}{36}+\frac{1}{9}+\frac{1}{12}+\frac{1}{18}+\frac{1}{36}=1

i.e., the equality (2.1.2) is satisfied.

Example 7: In a box, there are 7 pencils, 4 of which are red. Three pencils are randomly drawn from this box. Find the distribution law of the random variable XX, which is equal to the number of red pencils in the sample.

Solution. In a sample of three pencils, there may be no red pencils, one, two, or three pencils. Therefore, the random variable XX can take only four values: x1=0,x2=1,x3=2,x4=3x_{1}=0, x_{2}=1, x_{3}=2, x_{4}=3.

Let's find the probabilities of these values:

p1=P(X=0)=C40C33C73=135;p2=P(X=1)=C41C32C73=1235p3=P(X=2)=C42C31C73=1835;p4=P(X=3)=C43C30C73=435 \begin{array}{ll} p_{1}=P(X=0)=\frac{C_{4}^{0} \cdot C_{3}^{3}}{C_{7}^{3}}=\frac{1}{35} ; \quad p_{2}=P(X=1)=\frac{C_{4}^{1} \cdot C_{3}^{2}}{C_{7}^{3}}=\frac{12}{35} \\ p_{3}=P(X=2)=\frac{C_{4}^{2} \cdot C_{3}^{1}}{C_{7}^{3}}=\frac{18}{35} ; \quad p_{4}=P(X=3)=\frac{C_{4}^{3} \cdot C_{3}^{0}}{C_{7}^{3}}=\frac{4}{35} \end{array}

Therefore, the random variable XX has the following distribution law:

| XX | 0 | 1 | 2 | 3 |
| :---: | :---: | :---: | :---: | :---: |
| PP^{\cdot} | 135\frac{1}{35} | 1235\frac{12}{35} | 1835\frac{18}{35} | 435\frac{4}{35} |

Note that 1/35+12/35+18/35+4/35=11 / 35+12 / 35+18 / 35+4 / 35=1, i.e., the equality (2.1.2)(2.1 .2) is satisfied.

Source: NuminaMath-1.5, licensed Apache-2.0. Statement and solution reproduced as published; topic, difficulty and ordering added by this site.