Olympiad Maths Prep

Library / /6 of 29

Geometry Difficulty 5.9 AIME, harder Prove it Iran

Consider a triangle ABC\triangle ABC with incenter II. Let DD be the intersection point of BIBI and ACAC, and let CICI intersect the circumcircle of ABC\triangle ABC at MM. Point KK lies on the line MDMD such that KIA=90\angle KIA = 90^\circ. Let FF be the reflection of BB with respect to CC. Prove that BIKFBIKF is cyclic.

Solution

Let EE be the intersection point of line MKMK and the circumcircle of ABC\triangle ABC, then, since BEM=C2\angle BEM = \frac{\angle C}{2} and DIK=90AID\angle DIK = 90 - \angle AID, so BEM=DIK\angle BEM = \angle DIK, it follows that the points BB, II, KK, EE lie on a circle. Suppose BCBC intersects this circle at point FF', other than BB. Let NN be the intersection point of line BDBD and the circumcircle of ABC\triangle ABC and GG be where lines CMCM and BKBK meet.

Figure 1

Since MNAIMN \perp AI, noting the parallel lines, we have
IKMN=IDDN. \frac{IK}{MN} = \frac{ID}{DN}.
Now we have
IDDN=sin(C2)sin(B2)CINC, \frac{ID}{DN} = \frac{\sin(\frac{\angle C}{2})}{\sin(\frac{\angle B}{2})} \cdot \frac{CI}{NC},
and
CINC=BIMI, \frac{CI}{NC} = \frac{BI}{MI},
so we have
IKMN=sin(C2)sin(B2)CINC=BIMI. \frac{IK}{MN} = \frac{\sin(\frac{\angle C}{2})}{\sin(\frac{\angle B}{2})} \cdot \frac{CI}{NC} = \frac{BI}{MI}.
On the other hand, since MI=MBMI = MB we have
MNMI=sin(90A2)sin(C2). \frac{MN}{MI} = \frac{\sin(90^\circ - \frac{\angle A}{2})}{\sin(\frac{\angle C}{2})}.
So we get
KIsin(B2)=BIsin(90A2), KI \cdot \sin(\frac{\angle B}{2}) = BI \cdot \sin(90^\circ - \frac{\angle A}{2}),
and that easily gives us SMIB=SMIKS_{\triangle MIB} = S_{\triangle MIK}. Then we have BG=GKBG = GK and since KFB=KID=C2\angle KF'B = \angle KID = \frac{\angle C}{2} we have KFICKF' \parallel IC so FFF' \equiv F. Thus, BIKFBIKF is cyclic as desired. ■

Looking for a route rather than an archive? The track puts 2,000 problems in a working order, from AMC 10 level to the IMO shortlist.

Source: MathNet, licensed CC-BY-4.0. Statement and solution reproduced as published; topic and difficulty added by this site.